C18H38Na2O8S — CID 172848066
disodium;1-[2-(2-hydroxyethoxy)ethoxy]tetradecan-2-ol;sulfate (PubChem CID 172848066) has the molecular formula C18H38Na2O8S and a molecular weight of 460.54 g/mol. Its IUPAC name is disodium;1-[2-(2-hydroxyethoxy)ethoxy]tetradecan-2-ol;sulfate.
| Compound Name | disodium;1-[2-(2-hydroxyethoxy)ethoxy]tetradecan-2-ol;sulfate |
|---|---|
| PubChem CID | 172848066 |
| Molecular Formula | C18H38Na2O8S |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | disodium;1-[2-(2-hydroxyethoxy)ethoxy]tetradecan-2-ol;sulfate |
| SMILES | CCCCCCCCCCCCC(O)COCCOCCO.O=S(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C18H38O4.2Na.H2O4S/c1-2-3-4-5-6-7-8-9-10-11-12-18(20)17-22-16-15-21-14-13-19;;;1-5(2,3)4/h18-20H,2-17H2,1H3;;;(H2,1,2,3,4)/q;2*+1;/p-2 |
| InChIKey | XRTVVQBYUZXDMI-UHFFFAOYSA-L |
| XLogP | -3.65 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | -3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|