C15H34O7 — CID 174323318
3-hexoxypropane-1,2-diol;2-[2-(2-hydroxyethoxy)ethoxy]ethanol (PubChem CID 174323318) has the molecular formula C15H34O7 and a molecular weight of 326.43 g/mol. Its IUPAC name is 3-hexoxypropane-1,2-diol;2-[2-(2-hydroxyethoxy)ethoxy]ethanol.
| Compound Name | 3-hexoxypropane-1,2-diol;2-[2-(2-hydroxyethoxy)ethoxy]ethanol |
|---|---|
| PubChem CID | 174323318 |
| Molecular Formula | C15H34O7 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | 3-hexoxypropane-1,2-diol;2-[2-(2-hydroxyethoxy)ethoxy]ethanol |
| SMILES | CCCCCCOCC(O)CO.OCCOCCOCCO |
| InChI | InChI=1S/C9H20O3.C6H14O4/c1-2-3-4-5-6-12-8-9(11)7-10;7-1-3-9-5-6-10-4-2-8/h9-11H,2-8H2,1H3;7-8H,1-6H2 |
| InChIKey | YKYXUIHAXMFGFC-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|