C18H40O6 — CID 87375114
3-(2,3-dihydroxypropoxy)propane-1,2-diol;1-hexoxyhexane (PubChem CID 87375114) has the molecular formula C18H40O6 and a molecular weight of 352.51 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropoxy)propane-1,2-diol;1-hexoxyhexane.
| Compound Name | 3-(2,3-dihydroxypropoxy)propane-1,2-diol;1-hexoxyhexane |
|---|---|
| PubChem CID | 87375114 |
| Molecular Formula | C18H40O6 |
| Molecular Weight | 352.51 g/mol |
| Exact Mass | 352.28 |
| IUPAC Name | 3-(2,3-dihydroxypropoxy)propane-1,2-diol;1-hexoxyhexane |
| SMILES | CCCCCCOCCCCCC.OCC(O)COCC(O)CO |
| InChI | InChI=1S/C12H26O.C6H14O5/c1-3-5-7-9-11-13-12-10-8-6-4-2;7-1-5(9)3-11-4-6(10)2-8/h3-12H2,1-2H3;5-10H,1-4H2 |
| InChIKey | VZBYLUDIGOJUPG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.51 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|