C10H24O4 — CID 22908564
3-heptoxypropane-1,2-diol;hydrate (PubChem CID 22908564) has the molecular formula C10H24O4 and a molecular weight of 208.30 g/mol. Its IUPAC name is 3-heptoxypropane-1,2-diol;hydrate.
| Compound Name | 3-heptoxypropane-1,2-diol;hydrate |
|---|---|
| PubChem CID | 22908564 |
| Molecular Formula | C10H24O4 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 3-heptoxypropane-1,2-diol;hydrate |
| SMILES | CCCCCCCOCC(O)CO.O |
| InChI | InChI=1S/C10H22O3.H2O/c1-2-3-4-5-6-7-13-9-10(12)8-11;/h10-12H,2-9H2,1H3;1H2 |
| InChIKey | MZWLPXIJYXHXDC-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|