C23H46O3 — CID 101143228
(2S)-3-[(Z)-icos-9-enoxy]propane-1,2-diol (PubChem CID 101143228) has the molecular formula C23H46O3 and a molecular weight of 370.62 g/mol. Its IUPAC name is (2S)-3-[(Z)-icos-9-enoxy]propane-1,2-diol.
| Compound Name | (2S)-3-[(Z)-icos-9-enoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 101143228 |
| Molecular Formula | C23H46O3 |
| Molecular Weight | 370.62 g/mol |
| Exact Mass | 370.34 |
| IUPAC Name | (2S)-3-[(Z)-icos-9-enoxy]propane-1,2-diol |
| SMILES | CCCCCCCCCC/C=C\CCCCCCCCOC[C@@H](O)CO |
| InChI | InChI=1S/C23H46O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-26-22-23(25)21-24/h11-12,23-25H,2-10,13-22H2,1H3/b12-11-/t23-/m0/s1 |
| InChIKey | PZNQQDRPNQUIIG-DGVDTQEHSA-N |
| XLogP | 6.17 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.62 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|