C13H26O3 — CID 101275410
3-[(E)-dec-5-enoxy]propane-1,2-diol (PubChem CID 101275410) has the molecular formula C13H26O3 and a molecular weight of 230.35 g/mol. Its IUPAC name is 3-[(E)-dec-5-enoxy]propane-1,2-diol.
| Compound Name | 3-[(E)-dec-5-enoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 101275410 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | 3-[(E)-dec-5-enoxy]propane-1,2-diol |
| SMILES | CCCC/C=C/CCCCOCC(O)CO |
| InChI | InChI=1S/C13H26O3/c1-2-3-4-5-6-7-8-9-10-16-12-13(15)11-14/h5-6,13-15H,2-4,7-12H2,1H3/b6-5+ |
| InChIKey | ZXMZEINSFDCYIX-AATRIKPKSA-N |
| XLogP | 2.27 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|