C80H162O3 — CID 174793085
dodecakis(hex-1-ene);3-pentoxypropane-1,2-diol (PubChem CID 174793085) has the molecular formula C80H162O3 and a molecular weight of 1172.17 g/mol. Its IUPAC name is dodecakis(hex-1-ene);3-pentoxypropane-1,2-diol.
| Compound Name | dodecakis(hex-1-ene);3-pentoxypropane-1,2-diol |
|---|---|
| PubChem CID | 174793085 |
| Molecular Formula | C80H162O3 |
| Molecular Weight | 1172.17 g/mol |
| Exact Mass | 1171.25 |
| IUPAC Name | dodecakis(hex-1-ene);3-pentoxypropane-1,2-diol |
| SMILES | C=CCCCC.C=CCCCC.C=CCCCC.C=CCCCC.C=CCCCC.C=CCCCC.C=CCCCC.C=CCCCC.C=CCCCC.C=CCCCC.C=CCCCC.C=CCCCC.CCCCCOCC(O)CO |
| InChI | InChI=1S/C8H18O3.12C6H12/c1-2-3-4-5-11-7-8(10)6-9;12*1-3-5-6-4-2/h8-10H,2-7H2,1H3;12*3H,1,4-6H2,2H3 |
| InChIKey | SBWTYWWTPWGQDM-UHFFFAOYSA-N |
| XLogP | 28.90 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1172.17 |
| LogP ≤ 5 | 28.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|