C19H38O3 — CID 10470922
3-[(E)-hexadec-7-enoxy]propane-1,2-diol (PubChem CID 10470922) has the molecular formula C19H38O3 and a molecular weight of 314.51 g/mol. Its IUPAC name is 3-[(E)-hexadec-7-enoxy]propane-1,2-diol.
| Compound Name | 3-[(E)-hexadec-7-enoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 10470922 |
| Molecular Formula | C19H38O3 |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.28 |
| IUPAC Name | 3-[(E)-hexadec-7-enoxy]propane-1,2-diol |
| SMILES | CCCCCCCC/C=C/CCCCCCOCC(O)CO |
| InChI | InChI=1S/C19H38O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-22-18-19(21)17-20/h9-10,19-21H,2-8,11-18H2,1H3/b10-9+ |
| InChIKey | MUIXINATRJGCNW-MDZDMXLPSA-N |
| XLogP | 4.61 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|