C42H86O7 — CID 87482506
(Z)-1-[(Z)-octadec-9-enoxy]octadec-9-ene;bis(propane-1,2,3-triol) (PubChem CID 87482506) has the molecular formula C42H86O7 and a molecular weight of 703.14 g/mol. Its IUPAC name is (Z)-1-[(Z)-octadec-9-enoxy]octadec-9-ene;bis(propane-1,2,3-triol).
| Compound Name | (Z)-1-[(Z)-octadec-9-enoxy]octadec-9-ene;bis(propane-1,2,3-triol) |
|---|---|
| PubChem CID | 87482506 |
| Molecular Formula | C42H86O7 |
| Molecular Weight | 703.14 g/mol |
| Exact Mass | 702.64 |
| IUPAC Name | (Z)-1-[(Z)-octadec-9-enoxy]octadec-9-ene;bis(propane-1,2,3-triol) |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCCCCCCCC/C=C\CCCCCCCC.OCC(O)CO.OCC(O)CO |
| InChI | InChI=1S/C36H70O.2C3H8O3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;2*4-1-3(6)2-5/h17-20H,3-16,21-36H2,1-2H3;2*3-6H,1-2H2/b19-17-,20-18-;; |
| InChIKey | GBXBTQSHKZSHQQ-AXMZSLBLSA-N |
| XLogP | 9.74 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.14 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|