C21H42O3 — CID 50987897
3-[(E)-octadec-11-enoxy]propane-1,2-diol (PubChem CID 50987897) has the molecular formula C21H42O3 and a molecular weight of 342.56 g/mol. Its IUPAC name is 3-[(E)-octadec-11-enoxy]propane-1,2-diol.
| Compound Name | 3-[(E)-octadec-11-enoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 50987897 |
| Molecular Formula | C21H42O3 |
| Molecular Weight | 342.56 g/mol |
| Exact Mass | 342.31 |
| IUPAC Name | 3-[(E)-octadec-11-enoxy]propane-1,2-diol |
| SMILES | CCCCCC/C=C/CCCCCCCCCCOCC(O)CO |
| InChI | InChI=1S/C21H42O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24-20-21(23)19-22/h7-8,21-23H,2-6,9-20H2,1H3/b8-7+ |
| InChIKey | VPYHUTCCGRNLPL-BQYQJAHWSA-N |
| XLogP | 5.39 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.56 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|