C21H40O3 — CID 126713587
3-[(10Z,13Z)-octadeca-10,13-dienoxy]propane-1,2-diol (PubChem CID 126713587) has the molecular formula C21H40O3 and a molecular weight of 340.55 g/mol. Its IUPAC name is 3-[(10Z,13Z)-octadeca-10,13-dienoxy]propane-1,2-diol.
| Compound Name | 3-[(10Z,13Z)-octadeca-10,13-dienoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 126713587 |
| Molecular Formula | C21H40O3 |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.30 |
| IUPAC Name | 3-[(10Z,13Z)-octadeca-10,13-dienoxy]propane-1,2-diol |
| SMILES | CCCC/C=C\C/C=C\CCCCCCCCCOCC(O)CO |
| InChI | InChI=1S/C21H40O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24-20-21(23)19-22/h5-6,8-9,21-23H,2-4,7,10-20H2,1H3/b6-5-,9-8- |
| InChIKey | YPGCXXXVVBLJKS-AFJQJTPPSA-N |
| XLogP | 5.17 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|