C30H57O8P — CID 165215305
2,3-dihydroxypropyl [2-hydroxy-3-[(10Z,13Z,16Z)-tetracosa-10,13,16-trienoxy]propyl] hydrogen phosphate (PubChem CID 165215305) has the molecular formula C30H57O8P and a molecular weight of 576.75 g/mol. Its IUPAC name is 2,3-dihydroxypropyl [2-hydroxy-3-[(10Z,13Z,16Z)-tetracosa-10,13,16-trienoxy]propyl] hydrogen phosphate.
| Compound Name | 2,3-dihydroxypropyl [2-hydroxy-3-[(10Z,13Z,16Z)-tetracosa-10,13,16-trienoxy]propyl] hydrogen phosphate |
|---|---|
| PubChem CID | 165215305 |
| Molecular Formula | C30H57O8P |
| Molecular Weight | 576.75 g/mol |
| Exact Mass | 576.38 |
| IUPAC Name | 2,3-dihydroxypropyl [2-hydroxy-3-[(10Z,13Z,16Z)-tetracosa-10,13,16-trienoxy]propyl] hydrogen phosphate |
| SMILES | CCCCCCC/C=C\C/C=C\C/C=C\CCCCCCCCCOCC(O)COP(=O)(O)OCC(O)CO |
| InChI | InChI=1S/C30H57O8P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-36-26-30(33)28-38-39(34,35)37-27-29(32)25-31/h8-9,11-12,14-15,29-33H,2-7,10,13,16-28H2,1H3,(H,34,35)/b9-8-,12-11-,15-14- |
| InChIKey | GIASKUZSFDOGIV-ORZIMQNZSA-N |
| XLogP | 6.78 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.75 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|