C30H53O8P — CID 165300129
2,3-dihydroxypropyl [2-hydroxy-3-[(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoxy]propyl] hydrogen phosphate (PubChem CID 165300129) has the molecular formula C30H53O8P and a molecular weight of 572.72 g/mol. Its IUPAC name is 2,3-dihydroxypropyl [2-hydroxy-3-[(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoxy]propyl] hydrogen phosphate.
| Compound Name | 2,3-dihydroxypropyl [2-hydroxy-3-[(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoxy]propyl] hydrogen phosphate |
|---|---|
| PubChem CID | 165300129 |
| Molecular Formula | C30H53O8P |
| Molecular Weight | 572.72 g/mol |
| Exact Mass | 572.35 |
| IUPAC Name | 2,3-dihydroxypropyl [2-hydroxy-3-[(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoxy]propyl] hydrogen phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCCOCC(O)COP(=O)(O)OCC(O)CO |
| InChI | InChI=1S/C30H53O8P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-36-26-30(33)28-38-39(34,35)37-27-29(32)25-31/h3-4,6-7,9-10,12-13,15-16,29-33H,2,5,8,11,14,17-28H2,1H3,(H,34,35)/b4-3-,7-6-,10-9-,13-12-,16-15- |
| InChIKey | TZXIIRCKJOWBCH-JLNKQSITSA-N |
| XLogP | 6.33 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.72 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|