C32H55O8P — CID 165221275
2,3-dihydroxypropyl [3-[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoxy]-2-hydroxypropyl] hydrogen phosphate (PubChem CID 165221275) has the molecular formula C32H55O8P and a molecular weight of 598.76 g/mol. Its IUPAC name is 2,3-dihydroxypropyl [3-[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoxy]-2-hydroxypropyl] hydrogen phosphate.
| Compound Name | 2,3-dihydroxypropyl [3-[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoxy]-2-hydroxypropyl] hydrogen phosphate |
|---|---|
| PubChem CID | 165221275 |
| Molecular Formula | C32H55O8P |
| Molecular Weight | 598.76 g/mol |
| Exact Mass | 598.36 |
| IUPAC Name | 2,3-dihydroxypropyl [3-[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoxy]-2-hydroxypropyl] hydrogen phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCOCC(O)COP(=O)(O)OCC(O)CO |
| InChI | InChI=1S/C32H55O8P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-38-28-32(35)30-40-41(36,37)39-29-31(34)27-33/h3-4,6-7,9-10,12-13,15-16,18-19,31-35H,2,5,8,11,14,17,20-30H2,1H3,(H,36,37)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | HFWCVUPIQPUGRM-KUBAVDMBSA-N |
| XLogP | 6.89 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.76 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|