C50H83O9P — CID 165194165
[1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoxy]propan-2-yl] (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoate (PubChem CID 165194165) has the molecular formula C50H83O9P and a molecular weight of 859.18 g/mol. Its IUPAC name is [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoxy]propan-2-yl] (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoate.
| Compound Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoxy]propan-2-yl] (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoate |
|---|---|
| PubChem CID | 165194165 |
| Molecular Formula | C50H83O9P |
| Molecular Weight | 859.18 g/mol |
| Exact Mass | 858.58 |
| IUPAC Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoxy]propan-2-yl] (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCC(=O)OC(COCCCCCCCC/C=C\C/C=C\C/C=C\CC)COP(=O)(O)OCC(O)CO |
| InChI | InChI=1S/C50H83O9P/c1-3-5-7-9-11-13-15-17-19-21-22-23-24-25-26-27-28-30-32-34-36-38-40-42-50(53)59-49(47-58-60(54,55)57-45-48(52)44-51)46-56-43-41-39-37-35-33-31-29-20-18-16-14-12-10-8-6-4-2/h5-8,11-14,17-20,22-23,25-26,28,30,48-49,51-52H,3-4,9-10,15-16,21,24,27,29,31-47H2,1-2H3,(H,54,55)/b7-5-,8-6-,13-11-,14-12-,19-17-,20-18-,23-22-,26-25-,30-28- |
| InChIKey | CBVVWAKJLKAXAW-CPRHOVFLSA-N |
| XLogP | 13.03 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.18 |
| LogP ≤ 5 | 13.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|