C43H77O9P — CID 165226231
[1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoxy]propan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate (PubChem CID 165226231) has the molecular formula C43H77O9P and a molecular weight of 769.05 g/mol. Its IUPAC name is [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoxy]propan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate.
| Compound Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoxy]propan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate |
|---|---|
| PubChem CID | 165226231 |
| Molecular Formula | C43H77O9P |
| Molecular Weight | 769.05 g/mol |
| Exact Mass | 768.53 |
| IUPAC Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoxy]propan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCOCC(COP(=O)(O)OCC(O)CO)OC(=O)CCCCCCCCC/C=C\C/C=C\CCCCCC |
| InChI | InChI=1S/C43H77O9P/c1-3-5-7-9-11-13-15-17-19-20-21-22-23-25-27-29-31-33-35-43(46)52-42(40-51-53(47,48)50-38-41(45)37-44)39-49-36-34-32-30-28-26-24-18-16-14-12-10-8-6-4-2/h6,8,12-15,18-20,24,41-42,44-45H,3-5,7,9-11,16-17,21-23,25-40H2,1-2H3,(H,47,48)/b8-6-,14-12-,15-13-,20-19-,24-18- |
| InChIKey | HZLLLDOFXMFPIL-MUDGPAQJSA-N |
| XLogP | 11.19 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.05 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|