C41H73O9P — CID 165229616
[1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoxy]propan-2-yl] (Z)-pentadec-9-enoate (PubChem CID 165229616) has the molecular formula C41H73O9P and a molecular weight of 741.00 g/mol. Its IUPAC name is [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoxy]propan-2-yl] (Z)-pentadec-9-enoate.
| Compound Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoxy]propan-2-yl] (Z)-pentadec-9-enoate |
|---|---|
| PubChem CID | 165229616 |
| Molecular Formula | C41H73O9P |
| Molecular Weight | 741.00 g/mol |
| Exact Mass | 740.50 |
| IUPAC Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoxy]propan-2-yl] (Z)-pentadec-9-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCOCC(COP(=O)(O)OCC(O)CO)OC(=O)CCCCCCC/C=C\CCCCC |
| InChI | InChI=1S/C41H73O9P/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-24-26-28-30-32-34-47-37-40(38-49-51(45,46)48-36-39(43)35-42)50-41(44)33-31-29-27-25-23-16-14-12-10-8-6-4-2/h5,7,11-14,17-18,20-21,39-40,42-43H,3-4,6,8-10,15-16,19,22-38H2,1-2H3,(H,45,46)/b7-5-,13-11-,14-12-,18-17-,21-20- |
| InChIKey | IMYTWTGMWPUTEB-BEBUWKJTSA-N |
| XLogP | 10.41 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.00 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|