C42H73O9P — CID 165195102
[1-decoxy-3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxypropan-2-yl] (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoate (PubChem CID 165195102) has the molecular formula C42H73O9P and a molecular weight of 753.01 g/mol. Its IUPAC name is [1-decoxy-3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxypropan-2-yl] (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoate.
| Compound Name | [1-decoxy-3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxypropan-2-yl] (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoate |
|---|---|
| PubChem CID | 165195102 |
| Molecular Formula | C42H73O9P |
| Molecular Weight | 753.01 g/mol |
| Exact Mass | 752.50 |
| IUPAC Name | [1-decoxy-3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxypropan-2-yl] (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCC(=O)OC(COCCCCCCCCCC)COP(=O)(O)OCC(O)CO |
| InChI | InChI=1S/C42H73O9P/c1-3-5-7-9-11-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-30-32-34-42(45)51-41(39-50-52(46,47)49-37-40(44)36-43)38-48-35-33-31-29-12-10-8-6-4-2/h5,7,11,13,15-16,18-19,21-22,24-25,40-41,43-44H,3-4,6,8-10,12,14,17,20,23,26-39H2,1-2H3,(H,46,47)/b7-5-,13-11-,16-15-,19-18-,22-21-,25-24- |
| InChIKey | CFNYZRFIFSEJCE-GALCBNSZSA-N |
| XLogP | 10.58 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.01 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|