C45H81O9P — CID 165195028
[1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z)-nonadeca-9,12-dienoxy]propan-2-yl] (11Z,14Z,17Z)-icosa-11,14,17-trienoate (PubChem CID 165195028) has the molecular formula C45H81O9P and a molecular weight of 797.11 g/mol. Its IUPAC name is [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z)-nonadeca-9,12-dienoxy]propan-2-yl] (11Z,14Z,17Z)-icosa-11,14,17-trienoate.
| Compound Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z)-nonadeca-9,12-dienoxy]propan-2-yl] (11Z,14Z,17Z)-icosa-11,14,17-trienoate |
|---|---|
| PubChem CID | 165195028 |
| Molecular Formula | C45H81O9P |
| Molecular Weight | 797.11 g/mol |
| Exact Mass | 796.56 |
| IUPAC Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z)-nonadeca-9,12-dienoxy]propan-2-yl] (11Z,14Z,17Z)-icosa-11,14,17-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCCC(=O)OC(COCCCCCCCC/C=C\C/C=C\CCCCCC)COP(=O)(O)OCC(O)CO |
| InChI | InChI=1S/C45H81O9P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-45(48)54-44(42-53-55(49,50)52-40-43(47)39-46)41-51-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h5,7,11,13-14,16-17,19-20,22,43-44,46-47H,3-4,6,8-10,12,15,18,21,23-42H2,1-2H3,(H,49,50)/b7-5-,13-11-,16-14-,19-17-,22-20- |
| InChIKey | CFFJOZVQZXMIOO-JCXYDHFESA-N |
| XLogP | 11.97 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.11 |
| LogP ≤ 5 | 11.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|