C46H81O9P — CID 165260126
[1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoxy]propan-2-yl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 165260126) has the molecular formula C46H81O9P and a molecular weight of 809.12 g/mol. Its IUPAC name is [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoxy]propan-2-yl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoxy]propan-2-yl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 165260126 |
| Molecular Formula | C46H81O9P |
| Molecular Weight | 809.12 g/mol |
| Exact Mass | 808.56 |
| IUPAC Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoxy]propan-2-yl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCCCOCC(COP(=O)(O)OCC(O)CO)OC(=O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C46H81O9P/c1-3-5-7-9-11-13-15-17-19-20-21-22-23-25-27-29-31-33-35-37-39-52-42-45(43-54-56(50,51)53-41-44(48)40-47)55-46(49)38-36-34-32-30-28-26-24-18-16-14-12-10-8-6-4-2/h5,7,11-14,17-19,21-22,24,44-45,47-48H,3-4,6,8-10,15-16,20,23,25-43H2,1-2H3,(H,50,51)/b7-5-,13-11-,14-12-,19-17-,22-21-,24-18- |
| InChIKey | NDWZVZNSAOWLSQ-KXRHUYHJSA-N |
| XLogP | 12.14 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.12 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|