C43H75O9P — CID 165195080
[1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoxy]propan-2-yl] undecanoate (PubChem CID 165195080) has the molecular formula C43H75O9P and a molecular weight of 767.04 g/mol. Its IUPAC name is [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoxy]propan-2-yl] undecanoate.
| Compound Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoxy]propan-2-yl] undecanoate |
|---|---|
| PubChem CID | 165195080 |
| Molecular Formula | C43H75O9P |
| Molecular Weight | 767.04 g/mol |
| Exact Mass | 766.51 |
| IUPAC Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoxy]propan-2-yl] undecanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCOCC(COP(=O)(O)OCC(O)CO)OC(=O)CCCCCCCCCC |
| InChI | InChI=1S/C43H75O9P/c1-3-5-7-9-11-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-30-32-34-36-49-39-42(40-51-53(47,48)50-38-41(45)37-44)52-43(46)35-33-31-29-12-10-8-6-4-2/h5,7,11,13,15-16,18-19,21-22,24-25,41-42,44-45H,3-4,6,8-10,12,14,17,20,23,26-40H2,1-2H3,(H,47,48)/b7-5-,13-11-,16-15-,19-18-,22-21-,25-24- |
| InChIKey | CFMCTGVXZLYUQI-GALCBNSZSA-N |
| XLogP | 10.97 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.04 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|