C42H73O9P — CID 165195789
[1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoxy]propan-2-yl] decanoate (PubChem CID 165195789) has the molecular formula C42H73O9P and a molecular weight of 753.01 g/mol. Its IUPAC name is [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoxy]propan-2-yl] decanoate.
| Compound Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoxy]propan-2-yl] decanoate |
|---|---|
| PubChem CID | 165195789 |
| Molecular Formula | C42H73O9P |
| Molecular Weight | 753.01 g/mol |
| Exact Mass | 752.50 |
| IUPAC Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoxy]propan-2-yl] decanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCOCC(COP(=O)(O)OCC(O)CO)OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C42H73O9P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-29-31-33-35-48-38-41(39-50-52(46,47)49-37-40(44)36-43)51-42(45)34-32-30-28-10-8-6-4-2/h5,7,11-12,14-15,17-18,20-21,23-24,40-41,43-44H,3-4,6,8-10,13,16,19,22,25-39H2,1-2H3,(H,46,47)/b7-5-,12-11-,15-14-,18-17-,21-20-,24-23- |
| InChIKey | CIFJZUFOARWEMO-RLESYFSLSA-N |
| XLogP | 10.58 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.01 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|