C29H56O2 — CID 123987134
(2R)-1-octadeca-9,12-dienoxyundecan-2-ol (PubChem CID 123987134) has the molecular formula C29H56O2 and a molecular weight of 436.77 g/mol. Its IUPAC name is (2R)-1-octadeca-9,12-dienoxyundecan-2-ol.
| Compound Name | (2R)-1-octadeca-9,12-dienoxyundecan-2-ol |
|---|---|
| PubChem CID | 123987134 |
| Molecular Formula | C29H56O2 |
| Molecular Weight | 436.77 g/mol |
| Exact Mass | 436.43 |
| IUPAC Name | (2R)-1-octadeca-9,12-dienoxyundecan-2-ol |
| SMILES | CCCCCC=CCC=CCCCCCCCCOC[C@H](O)CCCCCCCCC |
| InChI | InChI=1S/C29H56O2/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-21-23-25-27-31-28-29(30)26-24-22-20-10-8-6-4-2/h11-12,14-15,29-30H,3-10,13,16-28H2,1-2H3/t29-/m1/s1 |
| InChIKey | DFYUUHUCCDDMOB-GDLZYMKVSA-N |
| XLogP | 9.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.77 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|