C8H18O3 — CID 56628191
(2S)-3-pentoxypropane-1,2-diol (PubChem CID 56628191) has the molecular formula C8H18O3 and a molecular weight of 162.23 g/mol. Its IUPAC name is (2S)-3-pentoxypropane-1,2-diol.
| Compound Name | (2S)-3-pentoxypropane-1,2-diol |
|---|---|
| PubChem CID | 56628191 |
| Molecular Formula | C8H18O3 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | (2S)-3-pentoxypropane-1,2-diol |
| SMILES | CCCCCOC[C@@H](O)CO |
| InChI | InChI=1S/C8H18O3/c1-2-3-4-5-11-7-8(10)6-9/h8-10H,2-7H2,1H3/t8-/m0/s1 |
| InChIKey | FQJXITFHANYMET-QMMMGPOBSA-N |
| XLogP | 0.55 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|