C17H38O4 — CID 86708450
3-decoxypropane-1,2-diol;ethoxyethane (PubChem CID 86708450) has the molecular formula C17H38O4 and a molecular weight of 306.49 g/mol. Its IUPAC name is 3-decoxypropane-1,2-diol;ethoxyethane.
| Compound Name | 3-decoxypropane-1,2-diol;ethoxyethane |
|---|---|
| PubChem CID | 86708450 |
| Molecular Formula | C17H38O4 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.28 |
| IUPAC Name | 3-decoxypropane-1,2-diol;ethoxyethane |
| SMILES | CCCCCCCCCCOCC(O)CO.CCOCC |
| InChI | InChI=1S/C13H28O3.C4H10O/c1-2-3-4-5-6-7-8-9-10-16-12-13(15)11-14;1-3-5-4-2/h13-15H,2-12H2,1H3;3-4H2,1-2H3 |
| InChIKey | OELJRXRODDNAAM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|