C14H30O5 — CID 86103535
3-(1-hydroxy-3-octoxypropan-2-yl)oxypropane-1,2-diol (PubChem CID 86103535) has the molecular formula C14H30O5 and a molecular weight of 278.39 g/mol. Its IUPAC name is 3-(1-hydroxy-3-octoxypropan-2-yl)oxypropane-1,2-diol.
| Compound Name | 3-(1-hydroxy-3-octoxypropan-2-yl)oxypropane-1,2-diol |
|---|---|
| PubChem CID | 86103535 |
| Molecular Formula | C14H30O5 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 3-(1-hydroxy-3-octoxypropan-2-yl)oxypropane-1,2-diol |
| SMILES | CCCCCCCCOCC(CO)OCC(O)CO |
| InChI | InChI=1S/C14H30O5/c1-2-3-4-5-6-7-8-18-12-14(10-16)19-11-13(17)9-15/h13-17H,2-12H2,1H3 |
| InChIKey | OVDVNGFLZNDBPC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|