C14H29ClO4 — CID 86111870
3-(1-chloro-3-octoxypropan-2-yl)oxypropane-1,2-diol (PubChem CID 86111870) has the molecular formula C14H29ClO4 and a molecular weight of 296.83 g/mol. Its IUPAC name is 3-(1-chloro-3-octoxypropan-2-yl)oxypropane-1,2-diol.
| Compound Name | 3-(1-chloro-3-octoxypropan-2-yl)oxypropane-1,2-diol |
|---|---|
| PubChem CID | 86111870 |
| Molecular Formula | C14H29ClO4 |
| Molecular Weight | 296.83 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 3-(1-chloro-3-octoxypropan-2-yl)oxypropane-1,2-diol |
| SMILES | CCCCCCCCOCC(CCl)OCC(O)CO |
| InChI | InChI=1S/C14H29ClO4/c1-2-3-4-5-6-7-8-18-12-14(9-15)19-11-13(17)10-16/h13-14,16-17H,2-12H2,1H3 |
| InChIKey | OMXCNRAUKQQTDU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.83 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|