C18H38O5 — CID 54180430
3-(2-dodecoxy-3-hydroxypropoxy)propane-1,2-diol (PubChem CID 54180430) has the molecular formula C18H38O5 and a molecular weight of 334.50 g/mol. Its IUPAC name is 3-(2-dodecoxy-3-hydroxypropoxy)propane-1,2-diol.
| Compound Name | 3-(2-dodecoxy-3-hydroxypropoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 54180430 |
| Molecular Formula | C18H38O5 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | 3-(2-dodecoxy-3-hydroxypropoxy)propane-1,2-diol |
| SMILES | CCCCCCCCCCCCOC(CO)COCC(O)CO |
| InChI | InChI=1S/C18H38O5/c1-2-3-4-5-6-7-8-9-10-11-12-23-18(14-20)16-22-15-17(21)13-19/h17-21H,2-16H2,1H3 |
| InChIKey | PBJVGZCJKJOSJG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|