C19H44O11 — CID 159075301
2-[2-(2-butoxyethoxy)ethoxy]ethanol;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;propane-1,2,3-triol (PubChem CID 159075301) has the molecular formula C19H44O11 and a molecular weight of 448.55 g/mol. Its IUPAC name is 2-[2-(2-butoxyethoxy)ethoxy]ethanol;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;propane-1,2,3-triol.
| Compound Name | 2-[2-(2-butoxyethoxy)ethoxy]ethanol;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;propane-1,2,3-triol |
|---|---|
| PubChem CID | 159075301 |
| Molecular Formula | C19H44O11 |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.29 |
| IUPAC Name | 2-[2-(2-butoxyethoxy)ethoxy]ethanol;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;propane-1,2,3-triol |
| SMILES | CCCCOCCOCCOCCO.OCC(O)CO.OCCOCCOCCO |
| InChI | InChI=1S/C10H22O4.C6H14O4.C3H8O3/c1-2-3-5-12-7-9-14-10-8-13-6-4-11;7-1-3-9-5-6-10-4-2-8;4-1-3(6)2-5/h11H,2-10H2,1H3;7-8H,1-6H2;3-6H,1-2H2 |
| InChIKey | KAEGBHGYCOKIIP-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 167.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|