About azane;1-[2-(2-hydroxyethoxy)ethoxy]tetradecan-2-ol;hydrate
azane;1-[2-(2-hydroxyethoxy)ethoxy]tetradecan-2-ol;hydrate (PubChem CID 173484113) has the molecular formula C18H43NO5
and a molecular weight of 353.54 g/mol. Its IUPAC name is azane;1-[2-(2-hydroxyethoxy)ethoxy]tetradecan-2-ol;hydrate.
Molecular Properties
| Compound Name | azane;1-[2-(2-hydroxyethoxy)ethoxy]tetradecan-2-ol;hydrate |
| PubChem CID | 173484113 |
| Molecular Formula | C18H43NO5 |
| Molecular Weight | 353.54 g/mol |
| Exact Mass | 353.31 |
| IUPAC Name | azane;1-[2-(2-hydroxyethoxy)ethoxy]tetradecan-2-ol;hydrate |
| SMILES | CCCCCCCCCCCCC(O)COCCOCCO.N.O |
| InChI | InChI=1S/C18H38O4.H3N.H2O/c1-2-3-4-5-6-7-8-9-10-11-12-18(20)17-22-16-15-21-14-13-19;;/h18-20H,2-17H2,1H3;1H3;1H2 |
| InChIKey | FYJQORFYFLSKCW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azane;1-[2-(2-hydroxyethoxy)ethoxy]tetradecan-2-ol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-[2-(2-hydroxyethoxy)ethoxy]tetradecan-2-ol;hydrate?
The IUPAC name of azane;1-[2-(2-hydroxyethoxy)ethoxy]tetradecan-2-ol;hydrate (CID 173484113) is azane;1-[2-(2-hydroxyethoxy)ethoxy]tetradecan-2-ol;hydrate.
What is the SMILES notation for azane;1-[2-(2-hydroxyethoxy)ethoxy]tetradecan-2-ol;hydrate?
The canonical SMILES for azane;1-[2-(2-hydroxyethoxy)ethoxy]tetradecan-2-ol;hydrate is CCCCCCCCCCCCC(O)COCCOCCO.N.O.
What is the InChIKey of azane;1-[2-(2-hydroxyethoxy)ethoxy]tetradecan-2-ol;hydrate?
The InChIKey is FYJQORFYFLSKCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38O4.H3N.H2O/c1-2-3-4-5-6-7-8-9-10-11-12-18(20)17-22-16-15-21-14-13-19;;/h18-20H,2-17H2,1H3;1H3;1H2.
What are the key properties of azane;1-[2-(2-hydroxyethoxy)ethoxy]tetradecan-2-ol;hydrate?
azane;1-[2-(2-hydroxyethoxy)ethoxy]tetradecan-2-ol;hydrate has a molecular weight of 353.54 g/mol, XLogP of 3.02, 18 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-[2-(2-hydroxyethoxy)ethoxy]tetradecan-2-ol;hydrate is sourced from PubChem (CID 173484113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).