C10H25NO4 — CID 87459588
azane;1-[2-(2-hydroxyethoxy)ethoxy]hexan-2-ol (PubChem CID 87459588) has the molecular formula C10H25NO4 and a molecular weight of 223.31 g/mol. Its IUPAC name is azane;1-[2-(2-hydroxyethoxy)ethoxy]hexan-2-ol.
| Compound Name | azane;1-[2-(2-hydroxyethoxy)ethoxy]hexan-2-ol |
|---|---|
| PubChem CID | 87459588 |
| Molecular Formula | C10H25NO4 |
| Molecular Weight | 223.31 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | azane;1-[2-(2-hydroxyethoxy)ethoxy]hexan-2-ol |
| SMILES | CCCCC(O)COCCOCCO.N |
| InChI | InChI=1S/C10H22O4.H3N/c1-2-3-4-10(12)9-14-8-7-13-6-5-11;/h10-12H,2-9H2,1H3;1H3 |
| InChIKey | YADYADJSRXQVFD-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 93.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|