C16H34O8 — CID 142397445
1,8-bis[2-(2-hydroxyethoxy)ethoxy]octane-2,7-diol (PubChem CID 142397445) has the molecular formula C16H34O8 and a molecular weight of 354.44 g/mol. Its IUPAC name is 1,8-bis[2-(2-hydroxyethoxy)ethoxy]octane-2,7-diol.
| Compound Name | 1,8-bis[2-(2-hydroxyethoxy)ethoxy]octane-2,7-diol |
|---|---|
| PubChem CID | 142397445 |
| Molecular Formula | C16H34O8 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 1,8-bis[2-(2-hydroxyethoxy)ethoxy]octane-2,7-diol |
| SMILES | OCCOCCOCC(O)CCCCC(O)COCCOCCO |
| InChI | InChI=1S/C16H34O8/c17-5-7-21-9-11-23-13-15(19)3-1-2-4-16(20)14-24-12-10-22-8-6-18/h15-20H,1-14H2 |
| InChIKey | MNMDAJXULPFJOU-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|