C8H17NO4 — CID 175269761
5-hydroxy-6-(2-hydroxyethoxy)hexanamide (PubChem CID 175269761) has the molecular formula C8H17NO4 and a molecular weight of 191.23 g/mol. Its IUPAC name is 5-hydroxy-6-(2-hydroxyethoxy)hexanamide.
| Compound Name | 5-hydroxy-6-(2-hydroxyethoxy)hexanamide |
|---|---|
| PubChem CID | 175269761 |
| Molecular Formula | C8H17NO4 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 5-hydroxy-6-(2-hydroxyethoxy)hexanamide |
| SMILES | NC(=O)CCCC(O)COCCO |
| InChI | InChI=1S/C8H17NO4/c9-8(12)3-1-2-7(11)6-13-5-4-10/h7,10-11H,1-6H2,(H2,9,12) |
| InChIKey | ZRAOKXKQDQHVIB-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|