C7H15NO4 — CID 172515689
3-(2-hydroxy-3-methoxypropoxy)propanamide (PubChem CID 172515689) has the molecular formula C7H15NO4 and a molecular weight of 177.20 g/mol. Its IUPAC name is 3-(2-hydroxy-3-methoxypropoxy)propanamide.
| Compound Name | 3-(2-hydroxy-3-methoxypropoxy)propanamide |
|---|---|
| PubChem CID | 172515689 |
| Molecular Formula | C7H15NO4 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 3-(2-hydroxy-3-methoxypropoxy)propanamide |
| SMILES | COCC(O)COCCC(N)=O |
| InChI | InChI=1S/C7H15NO4/c1-11-4-6(9)5-12-3-2-7(8)10/h6,9H,2-5H2,1H3,(H2,8,10) |
| InChIKey | WUKSTYMTRSENBC-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|