C13H25N3O6 — CID 123809562
3-[3-(3-amino-3-oxopropoxy)-2-[(3-amino-3-oxopropoxy)methyl]propoxy]propanamide (PubChem CID 123809562) has the molecular formula C13H25N3O6 and a molecular weight of 319.36 g/mol. Its IUPAC name is 3-[3-(3-amino-3-oxopropoxy)-2-[(3-amino-3-oxopropoxy)methyl]propoxy]propanamide.
| Compound Name | 3-[3-(3-amino-3-oxopropoxy)-2-[(3-amino-3-oxopropoxy)methyl]propoxy]propanamide |
|---|---|
| PubChem CID | 123809562 |
| Molecular Formula | C13H25N3O6 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 3-[3-(3-amino-3-oxopropoxy)-2-[(3-amino-3-oxopropoxy)methyl]propoxy]propanamide |
| SMILES | NC(=O)CCOCC(COCCC(N)=O)COCCC(N)=O |
| InChI | InChI=1S/C13H25N3O6/c14-11(17)1-4-20-7-10(8-21-5-2-12(15)18)9-22-6-3-13(16)19/h10H,1-9H2,(H2,14,17)(H2,15,18)(H2,16,19) |
| InChIKey | QICZJNNLMUOLHF-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 156.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|