C7H16N2O4 — CID 121421909
4-[(2S)-2-amino-3,3-dihydroxypropoxy]butanamide (PubChem CID 121421909) has the molecular formula C7H16N2O4 and a molecular weight of 192.21 g/mol. Its IUPAC name is 4-[(2S)-2-amino-3,3-dihydroxypropoxy]butanamide.
| Compound Name | 4-[(2S)-2-amino-3,3-dihydroxypropoxy]butanamide |
|---|---|
| PubChem CID | 121421909 |
| Molecular Formula | C7H16N2O4 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 4-[(2S)-2-amino-3,3-dihydroxypropoxy]butanamide |
| SMILES | NC(=O)CCCOC[C@H](N)C(O)O |
| InChI | InChI=1S/C7H16N2O4/c8-5(7(11)12)4-13-3-1-2-6(9)10/h5,7,11-12H,1-4,8H2,(H2,9,10)/t5-/m0/s1 |
| InChIKey | PUKQIVAAPRHNRE-YFKPBYRVSA-N |
| XLogP | -2.09 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|