About 4-[(2S)-2-amino-3,3-dihydroxypropoxy]butanamide
4-[(2S)-2-amino-3,3-dihydroxypropoxy]butanamide (PubChem CID 121421909) has the molecular formula C7H16N2O4
and a molecular weight of 192.21 g/mol. Its IUPAC name is 4-[(2S)-2-amino-3,3-dihydroxypropoxy]butanamide.
Molecular Properties
| Compound Name | 4-[(2S)-2-amino-3,3-dihydroxypropoxy]butanamide |
| PubChem CID | 121421909 |
| Molecular Formula | C7H16N2O4 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 4-[(2S)-2-amino-3,3-dihydroxypropoxy]butanamide |
| SMILES | NC(=O)CCCOC[C@H](N)C(O)O |
| InChI | InChI=1S/C7H16N2O4/c8-5(7(11)12)4-13-3-1-2-6(9)10/h5,7,11-12H,1-4,8H2,(H2,9,10)/t5-/m0/s1 |
| InChIKey | PUKQIVAAPRHNRE-YFKPBYRVSA-N |
| XLogP | -2.09 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2S)-2-amino-3,3-dihydroxypropoxy]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2S)-2-amino-3,3-dihydroxypropoxy]butanamide?
The IUPAC name of 4-[(2S)-2-amino-3,3-dihydroxypropoxy]butanamide (CID 121421909) is 4-[(2S)-2-amino-3,3-dihydroxypropoxy]butanamide.
What is the SMILES notation for 4-[(2S)-2-amino-3,3-dihydroxypropoxy]butanamide?
The canonical SMILES for 4-[(2S)-2-amino-3,3-dihydroxypropoxy]butanamide is NC(=O)CCCOC[C@H](N)C(O)O.
What is the InChIKey of 4-[(2S)-2-amino-3,3-dihydroxypropoxy]butanamide?
The InChIKey is PUKQIVAAPRHNRE-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H16N2O4/c8-5(7(11)12)4-13-3-1-2-6(9)10/h5,7,11-12H,1-4,8H2,(H2,9,10)/t5-/m0/s1.
What are the key properties of 4-[(2S)-2-amino-3,3-dihydroxypropoxy]butanamide?
4-[(2S)-2-amino-3,3-dihydroxypropoxy]butanamide has a molecular weight of 192.21 g/mol, XLogP of -2.09, 7 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2S)-2-amino-3,3-dihydroxypropoxy]butanamide is sourced from PubChem (CID 121421909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).