About 3-dodecoxypropanamide;hydrobromide
3-dodecoxypropanamide;hydrobromide (PubChem CID 175357705) has the molecular formula C15H32BrNO2
and a molecular weight of 338.33 g/mol. Its IUPAC name is 3-dodecoxypropanamide;hydrobromide.
Molecular Properties
| Compound Name | 3-dodecoxypropanamide;hydrobromide |
| PubChem CID | 175357705 |
| Molecular Formula | C15H32BrNO2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 3-dodecoxypropanamide;hydrobromide |
| SMILES | Br.CCCCCCCCCCCCOCCC(N)=O |
| InChI | InChI=1S/C15H31NO2.BrH/c1-2-3-4-5-6-7-8-9-10-11-13-18-14-12-15(16)17;/h2-14H2,1H3,(H2,16,17);1H |
| InChIKey | QEKQMFBBFANKNR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-dodecoxypropanamide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-dodecoxypropanamide;hydrobromide?
The IUPAC name of 3-dodecoxypropanamide;hydrobromide (CID 175357705) is 3-dodecoxypropanamide;hydrobromide.
What is the SMILES notation for 3-dodecoxypropanamide;hydrobromide?
The canonical SMILES for 3-dodecoxypropanamide;hydrobromide is Br.CCCCCCCCCCCCOCCC(N)=O.
What is the InChIKey of 3-dodecoxypropanamide;hydrobromide?
The InChIKey is QEKQMFBBFANKNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NO2.BrH/c1-2-3-4-5-6-7-8-9-10-11-13-18-14-12-15(16)17;/h2-14H2,1H3,(H2,16,17);1H.
What are the key properties of 3-dodecoxypropanamide;hydrobromide?
3-dodecoxypropanamide;hydrobromide has a molecular weight of 338.33 g/mol, XLogP of 4.38, 14 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-dodecoxypropanamide;hydrobromide is sourced from PubChem (CID 175357705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).