C15H31NO2 — CID 54483018
2-tridecoxyacetamide (PubChem CID 54483018) has the molecular formula C15H31NO2 and a molecular weight of 257.42 g/mol. Its IUPAC name is 2-tridecoxyacetamide.
| Compound Name | 2-tridecoxyacetamide |
|---|---|
| PubChem CID | 54483018 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | 2-tridecoxyacetamide |
| SMILES | CCCCCCCCCCCCCOCC(N)=O |
| InChI | InChI=1S/C15H31NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-18-14-15(16)17/h2-14H2,1H3,(H2,16,17) |
| InChIKey | RKRALSYSHZZBHP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|