C12H25NaO3 — CID 173154900
sodium;2-decoxyacetic acid;hydride (PubChem CID 173154900) has the molecular formula C12H25NaO3 and a molecular weight of 240.32 g/mol. Its IUPAC name is sodium;2-decoxyacetic acid;hydride.
| Compound Name | sodium;2-decoxyacetic acid;hydride |
|---|---|
| PubChem CID | 173154900 |
| Molecular Formula | C12H25NaO3 |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | sodium;2-decoxyacetic acid;hydride |
| SMILES | CCCCCCCCCCOCC(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C12H24O3.Na.H/c1-2-3-4-5-6-7-8-9-10-15-11-12(13)14;;/h2-11H2,1H3,(H,13,14);;/q;+1;-1 |
| InChIKey | FTROFQPHAOBRBD-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|