C14H29NaO3 — CID 173155180
sodium;2-dodecoxyacetic acid;hydride (PubChem CID 173155180) has the molecular formula C14H29NaO3 and a molecular weight of 268.37 g/mol. Its IUPAC name is sodium;2-dodecoxyacetic acid;hydride.
| Compound Name | sodium;2-dodecoxyacetic acid;hydride |
|---|---|
| PubChem CID | 173155180 |
| Molecular Formula | C14H29NaO3 |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | sodium;2-dodecoxyacetic acid;hydride |
| SMILES | CCCCCCCCCCCCOCC(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C14H28O3.Na.H/c1-2-3-4-5-6-7-8-9-10-11-12-17-13-14(15)16;;/h2-13H2,1H3,(H,15,16);;/q;+1;-1 |
| InChIKey | SJIKNOXRMKSSNV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|