C10H20O4 — CID 87690059
2-(3-pentoxypropoxy)acetic acid (PubChem CID 87690059) has the molecular formula C10H20O4 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-(3-pentoxypropoxy)acetic acid.
| Compound Name | 2-(3-pentoxypropoxy)acetic acid |
|---|---|
| PubChem CID | 87690059 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 2-(3-pentoxypropoxy)acetic acid |
| SMILES | CCCCCOCCCOCC(=O)O |
| InChI | InChI=1S/C10H20O4/c1-2-3-4-6-13-7-5-8-14-9-10(11)12/h2-9H2,1H3,(H,11,12) |
| InChIKey | OBLUZXBIFJZTCZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|