C17H36O7 — CID 174802601
2-ethoxyacetic acid;1-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]pentane (PubChem CID 174802601) has the molecular formula C17H36O7 and a molecular weight of 352.47 g/mol. Its IUPAC name is 2-ethoxyacetic acid;1-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]pentane.
| Compound Name | 2-ethoxyacetic acid;1-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]pentane |
|---|---|
| PubChem CID | 174802601 |
| Molecular Formula | C17H36O7 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | 2-ethoxyacetic acid;1-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]pentane |
| SMILES | CCCCCOCCOCCOCCOCC.CCOCC(=O)O |
| InChI | InChI=1S/C13H28O4.C4H8O3/c1-3-5-6-7-15-10-11-17-13-12-16-9-8-14-4-2;1-2-7-3-4(5)6/h3-13H2,1-2H3;2-3H2,1H3,(H,5,6) |
| InChIKey | QDGKTHPGEGEHAW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|