2-ethoxyacetic acid

C8H16O6 — CID 159744705

IUPAC2-ethoxyacetic acid
SMILESCCOCC(=O)O.CCOCC(=O)O
InChIInChI=1S/2C4H8O3/c2*1-2-7-3-4(5)6/h2*2-3H2,1H3,(H,5,6)
InChIKeyNCWZYHTVPGLGMN-UHFFFAOYSA-N
MW208.21 g/mol
LogP0.22
Rot. Bonds6

About 2-ethoxyacetic acid

2-ethoxyacetic acid (PubChem CID 159744705) has the molecular formula C8H16O6 and a molecular weight of 208.21 g/mol. Its IUPAC name is 2-ethoxyacetic acid.

Molecular Properties

Compound Name2-ethoxyacetic acid
PubChem CID159744705
Molecular FormulaC8H16O6
Molecular Weight208.21 g/mol
Exact Mass208.09
IUPAC Name2-ethoxyacetic acid
SMILESCCOCC(=O)O.CCOCC(=O)O
InChIInChI=1S/2C4H8O3/c2*1-2-7-3-4(5)6/h2*2-3H2,1H3,(H,5,6)
InChIKeyNCWZYHTVPGLGMN-UHFFFAOYSA-N
XLogP0.22
TPSA93.06 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.21
LogP ≤ 50.22
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-ethoxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethoxyacetic acid?
The IUPAC name of 2-ethoxyacetic acid (CID 159744705) is 2-ethoxyacetic acid.
What is the SMILES notation for 2-ethoxyacetic acid?
The canonical SMILES for 2-ethoxyacetic acid is CCOCC(=O)O.CCOCC(=O)O.
What is the InChIKey of 2-ethoxyacetic acid?
The InChIKey is NCWZYHTVPGLGMN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H8O3/c2*1-2-7-3-4(5)6/h2*2-3H2,1H3,(H,5,6).
What are the key properties of 2-ethoxyacetic acid?
2-ethoxyacetic acid has a molecular weight of 208.21 g/mol, XLogP of 0.22, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyacetic acid is sourced from PubChem (CID 159744705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).