About 2-aminooxyacetic acid;chloromethane;2-ethoxyacetic acid
2-aminooxyacetic acid;chloromethane;2-ethoxyacetic acid (PubChem CID 158293749) has the molecular formula C7H16ClNO6
and a molecular weight of 245.66 g/mol. Its IUPAC name is 2-aminooxyacetic acid;chloromethane;2-ethoxyacetic acid.
Molecular Properties
| Compound Name | 2-aminooxyacetic acid;chloromethane;2-ethoxyacetic acid |
| PubChem CID | 158293749 |
| Molecular Formula | C7H16ClNO6 |
| Molecular Weight | 245.66 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 2-aminooxyacetic acid;chloromethane;2-ethoxyacetic acid |
| SMILES | CCOCC(=O)O.CCl.NOCC(=O)O |
| InChI | InChI=1S/C4H8O3.C2H5NO3.CH3Cl/c1-2-7-3-4(5)6;3-6-1-2(4)5;1-2/h2-3H2,1H3,(H,5,6);1,3H2,(H,4,5);1H3 |
| InChIKey | GLQXQSYUFRXVJC-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.66 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-aminooxyacetic acid;chloromethane;2-ethoxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminooxyacetic acid;chloromethane;2-ethoxyacetic acid?
The IUPAC name of 2-aminooxyacetic acid;chloromethane;2-ethoxyacetic acid (CID 158293749) is 2-aminooxyacetic acid;chloromethane;2-ethoxyacetic acid.
What is the SMILES notation for 2-aminooxyacetic acid;chloromethane;2-ethoxyacetic acid?
The canonical SMILES for 2-aminooxyacetic acid;chloromethane;2-ethoxyacetic acid is CCOCC(=O)O.CCl.NOCC(=O)O.
What is the InChIKey of 2-aminooxyacetic acid;chloromethane;2-ethoxyacetic acid?
The InChIKey is GLQXQSYUFRXVJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O3.C2H5NO3.CH3Cl/c1-2-7-3-4(5)6;3-6-1-2(4)5;1-2/h2-3H2,1H3,(H,5,6);1,3H2,(H,4,5);1H3.
What are the key properties of 2-aminooxyacetic acid;chloromethane;2-ethoxyacetic acid?
2-aminooxyacetic acid;chloromethane;2-ethoxyacetic acid has a molecular weight of 245.66 g/mol, XLogP of -0.08, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminooxyacetic acid;chloromethane;2-ethoxyacetic acid is sourced from PubChem (CID 158293749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).