dichloromethane;2-ethoxyacetic acid

C5H10Cl2O3 — CID 87359195

IUPACdichloromethane;2-ethoxyacetic acid
SMILESCCOCC(=O)O.ClCCl
InChIInChI=1S/C4H8O3.CH2Cl2/c1-2-7-3-4(5)6;2-1-3/h2-3H2,1H3,(H,5,6);1H2
InChIKeyFZOCVFOBBVZNOB-UHFFFAOYSA-N
MW189.04 g/mol
LogP1.53
Rot. Bonds3

About dichloromethane;2-ethoxyacetic acid

dichloromethane;2-ethoxyacetic acid (PubChem CID 87359195) has the molecular formula C5H10Cl2O3 and a molecular weight of 189.04 g/mol. Its IUPAC name is dichloromethane;2-ethoxyacetic acid.

Molecular Properties

Compound Namedichloromethane;2-ethoxyacetic acid
PubChem CID87359195
Molecular FormulaC5H10Cl2O3
Molecular Weight189.04 g/mol
Exact Mass188.00
IUPAC Namedichloromethane;2-ethoxyacetic acid
SMILESCCOCC(=O)O.ClCCl
InChIInChI=1S/C4H8O3.CH2Cl2/c1-2-7-3-4(5)6;2-1-3/h2-3H2,1H3,(H,5,6);1H2
InChIKeyFZOCVFOBBVZNOB-UHFFFAOYSA-N
XLogP1.53
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.04
LogP ≤ 51.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze dichloromethane;2-ethoxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dichloromethane;2-ethoxyacetic acid?
The IUPAC name of dichloromethane;2-ethoxyacetic acid (CID 87359195) is dichloromethane;2-ethoxyacetic acid.
What is the SMILES notation for dichloromethane;2-ethoxyacetic acid?
The canonical SMILES for dichloromethane;2-ethoxyacetic acid is CCOCC(=O)O.ClCCl.
What is the InChIKey of dichloromethane;2-ethoxyacetic acid?
The InChIKey is FZOCVFOBBVZNOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O3.CH2Cl2/c1-2-7-3-4(5)6;2-1-3/h2-3H2,1H3,(H,5,6);1H2.
What are the key properties of dichloromethane;2-ethoxyacetic acid?
dichloromethane;2-ethoxyacetic acid has a molecular weight of 189.04 g/mol, XLogP of 1.53, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;2-ethoxyacetic acid is sourced from PubChem (CID 87359195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).