About dichloromethane;2-ethoxyacetic acid
dichloromethane;2-ethoxyacetic acid (PubChem CID 87359195) has the molecular formula C5H10Cl2O3
and a molecular weight of 189.04 g/mol. Its IUPAC name is dichloromethane;2-ethoxyacetic acid.
Molecular Properties
| Compound Name | dichloromethane;2-ethoxyacetic acid |
| PubChem CID | 87359195 |
| Molecular Formula | C5H10Cl2O3 |
| Molecular Weight | 189.04 g/mol |
| Exact Mass | 188.00 |
| IUPAC Name | dichloromethane;2-ethoxyacetic acid |
| SMILES | CCOCC(=O)O.ClCCl |
| InChI | InChI=1S/C4H8O3.CH2Cl2/c1-2-7-3-4(5)6;2-1-3/h2-3H2,1H3,(H,5,6);1H2 |
| InChIKey | FZOCVFOBBVZNOB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.04 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze dichloromethane;2-ethoxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethane;2-ethoxyacetic acid?
The IUPAC name of dichloromethane;2-ethoxyacetic acid (CID 87359195) is dichloromethane;2-ethoxyacetic acid.
What is the SMILES notation for dichloromethane;2-ethoxyacetic acid?
The canonical SMILES for dichloromethane;2-ethoxyacetic acid is CCOCC(=O)O.ClCCl.
What is the InChIKey of dichloromethane;2-ethoxyacetic acid?
The InChIKey is FZOCVFOBBVZNOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O3.CH2Cl2/c1-2-7-3-4(5)6;2-1-3/h2-3H2,1H3,(H,5,6);1H2.
What are the key properties of dichloromethane;2-ethoxyacetic acid?
dichloromethane;2-ethoxyacetic acid has a molecular weight of 189.04 g/mol, XLogP of 1.53, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;2-ethoxyacetic acid is sourced from PubChem (CID 87359195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).