About 2-(carboxymethoxy)acetic acid;sulfane
2-(carboxymethoxy)acetic acid;sulfane (PubChem CID 158807579) has the molecular formula C4H8O5S
and a molecular weight of 168.17 g/mol. Its IUPAC name is 2-(carboxymethoxy)acetic acid;sulfane.
Molecular Properties
| Compound Name | 2-(carboxymethoxy)acetic acid;sulfane |
| PubChem CID | 158807579 |
| Molecular Formula | C4H8O5S |
| Molecular Weight | 168.17 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | 2-(carboxymethoxy)acetic acid;sulfane |
| SMILES | O=C(O)COCC(=O)O.S |
| InChI | InChI=1S/C4H6O5.H2S/c5-3(6)1-9-2-4(7)8;/h1-2H2,(H,5,6)(H,7,8);1H2 |
| InChIKey | UXEIPXJBVYMRKX-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.17 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(carboxymethoxy)acetic acid;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(carboxymethoxy)acetic acid;sulfane?
The IUPAC name of 2-(carboxymethoxy)acetic acid;sulfane (CID 158807579) is 2-(carboxymethoxy)acetic acid;sulfane.
What is the SMILES notation for 2-(carboxymethoxy)acetic acid;sulfane?
The canonical SMILES for 2-(carboxymethoxy)acetic acid;sulfane is O=C(O)COCC(=O)O.S.
What is the InChIKey of 2-(carboxymethoxy)acetic acid;sulfane?
The InChIKey is UXEIPXJBVYMRKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O5.H2S/c5-3(6)1-9-2-4(7)8;/h1-2H2,(H,5,6)(H,7,8);1H2.
What are the key properties of 2-(carboxymethoxy)acetic acid;sulfane?
2-(carboxymethoxy)acetic acid;sulfane has a molecular weight of 168.17 g/mol, XLogP of -0.71, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(carboxymethoxy)acetic acid;sulfane is sourced from PubChem (CID 158807579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).