2-(fluoromethoxy)acetic acid

C3H5FO3 — CID 162467662

IUPAC2-(fluoromethoxy)acetic acid
SMILESO=C(O)COCF
InChIInChI=1S/C3H5FO3/c4-2-7-1-3(5)6/h1-2H2,(H,5,6)
InChIKeyMBARCFNXJZEZOQ-UHFFFAOYSA-N
MW108.07 g/mol
LogP0.01
Rot. Bonds3

About 2-(fluoromethoxy)acetic acid

2-(fluoromethoxy)acetic acid (PubChem CID 162467662) has the molecular formula C3H5FO3 and a molecular weight of 108.07 g/mol. Its IUPAC name is 2-(fluoromethoxy)acetic acid.

Molecular Properties

Compound Name2-(fluoromethoxy)acetic acid
PubChem CID162467662
Molecular FormulaC3H5FO3
Molecular Weight108.07 g/mol
Exact Mass108.02
IUPAC Name2-(fluoromethoxy)acetic acid
SMILESO=C(O)COCF
InChIInChI=1S/C3H5FO3/c4-2-7-1-3(5)6/h1-2H2,(H,5,6)
InChIKeyMBARCFNXJZEZOQ-UHFFFAOYSA-N
XLogP0.01
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500108.07
LogP ≤ 50.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(fluoromethoxy)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(carboxymethoxy)acetic acid;sulfane
CID 158807579
2-(carboxymethoxy)acetic acid;hydrochloride
CID 174705448
2-(12-fluorododecoxy)acetic acid
CID 21195352
2-ethoxyacetic acid
CID 159744705
2-(2-hydroxyprop-2-enoxy)acetic acid
CID 59294122
2-[3-(carboxymethoxy)-2,2-bis(carboxymethoxymethyl)propoxy]acetic acid
CID 12729088
carbonic acid;2-ethoxyacetic acid
CID 174869478
2-(3-methyl-2-propan-2-ylbutoxy)acetic acid
CID 87847477
2-[2-(carboxymethoxy)ethoxy]acetic acid;sulfuric acid
CID 90826502
2-[2-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]acetic acid
CID 126843434
2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid
CID 15118673
dichloromethane;2-ethoxyacetic acid
CID 87359195

Frequently Asked Questions

What is the IUPAC name of 2-(fluoromethoxy)acetic acid?
The IUPAC name of 2-(fluoromethoxy)acetic acid (CID 162467662) is 2-(fluoromethoxy)acetic acid.
What is the SMILES notation for 2-(fluoromethoxy)acetic acid?
The canonical SMILES for 2-(fluoromethoxy)acetic acid is O=C(O)COCF.
What is the InChIKey of 2-(fluoromethoxy)acetic acid?
The InChIKey is MBARCFNXJZEZOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5FO3/c4-2-7-1-3(5)6/h1-2H2,(H,5,6).
What are the key properties of 2-(fluoromethoxy)acetic acid?
2-(fluoromethoxy)acetic acid has a molecular weight of 108.07 g/mol, XLogP of 0.01, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(fluoromethoxy)acetic acid is sourced from PubChem (CID 162467662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).