C14H27FO3 — CID 21195352
2-(12-fluorododecoxy)acetic acid (PubChem CID 21195352) has the molecular formula C14H27FO3 and a molecular weight of 262.36 g/mol. Its IUPAC name is 2-(12-fluorododecoxy)acetic acid.
| Compound Name | 2-(12-fluorododecoxy)acetic acid |
|---|---|
| PubChem CID | 21195352 |
| Molecular Formula | C14H27FO3 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 2-(12-fluorododecoxy)acetic acid |
| SMILES | O=C(O)COCCCCCCCCCCCCF |
| InChI | InChI=1S/C14H27FO3/c15-11-9-7-5-3-1-2-4-6-8-10-12-18-13-14(16)17/h1-13H2,(H,16,17) |
| InChIKey | HJNJHTUIRCBQCW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|