C14H26O6Se — CID 155770977
2-[5-[5-(carboxymethoxy)pentylselanyl]pentoxy]acetic acid (PubChem CID 155770977) has the molecular formula C14H26O6Se and a molecular weight of 369.32 g/mol. Its IUPAC name is 2-[5-[5-(carboxymethoxy)pentylselanyl]pentoxy]acetic acid.
| Compound Name | 2-[5-[5-(carboxymethoxy)pentylselanyl]pentoxy]acetic acid |
|---|---|
| PubChem CID | 155770977 |
| Molecular Formula | C14H26O6Se |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 2-[5-[5-(carboxymethoxy)pentylselanyl]pentoxy]acetic acid |
| SMILES | O=C(O)COCCCCC[Se]CCCCCOCC(=O)O |
| InChI | InChI=1S/C14H26O6Se/c15-13(16)11-19-7-3-1-5-9-21-10-6-2-4-8-20-12-14(17)18/h1-12H2,(H,15,16)(H,17,18) |
| InChIKey | RMPOYWVYDOMKMX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|