C6H12O10S — CID 90826502
2-[2-(carboxymethoxy)ethoxy]acetic acid;sulfuric acid (PubChem CID 90826502) has the molecular formula C6H12O10S and a molecular weight of 276.22 g/mol. Its IUPAC name is 2-[2-(carboxymethoxy)ethoxy]acetic acid;sulfuric acid.
| Compound Name | 2-[2-(carboxymethoxy)ethoxy]acetic acid;sulfuric acid |
|---|---|
| PubChem CID | 90826502 |
| Molecular Formula | C6H12O10S |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 2-[2-(carboxymethoxy)ethoxy]acetic acid;sulfuric acid |
| SMILES | O=C(O)COCCOCC(=O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C6H10O6.H2O4S/c7-5(8)3-11-1-2-12-4-6(9)10;1-5(2,3)4/h1-4H2,(H,7,8)(H,9,10);(H2,1,2,3,4) |
| InChIKey | DQGIDKDUAAIOIO-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|